Mühendislik Fakültesi
Anlık RSS Bilgilendirmesi İçin Tıklayınız.Düzenli bilgilendirme E-Postaları almak için listemize kaydolabilirsiniz.

Almanca II

Ders KoduYarıyıl Ders Adı T/U/L Türü Öğrenim Dili AKTS
YDD0002 Almanca II 3/0/0 SAD Almanca 3
Dersin Amacı
 Farklı bir dille birlikte yeni bir kültürü tanıma, ön yargıları ortadan kaldırma A1.1. basamağında yürüttüğümüz programla öğrenciler dolaysız anlatımlarda cümleleri ve sıkça kullanılan sözcükleri anlayabilirler.( kişinin kendisi, ailesi, alışveriş, iş ve yakın çevresi ile ilgili bilgiler vb.) Yabancı olmadığı basit ve sıkça karşılaşılan durumlarda iletişim kurabilir. Basit ifadelerle nereli olduğunu, eğitimini, yakın çevresini ve somut ihtiyaçlarını anlatabilir. 3. Kendilerini ve başkalarını tanıtabilmelerini, başka kişilere kişisel sorular yöneltebilmelerini ve bu tür sorulara karşılık verebilmelerini(nerede oturdukları, kimleri tanıdıkları, nelerden hoşlandıkları vb.) 4.Kültürel dağarcıklarını zenginleştirme  5 Karşısındakiler yavaş ve anlaşılır konuşur ve yardımcı olurlarsa onlarla basit şekilde anlaşabilmeleri bu program sonucunda mümkündür.

Ön Koşullar yok
Eş Koşullar yok
Özel Koşullar yok
Öğretim Üyeleri Ayşe Güvenir
Ders Gün,Saat ve Yeri salı, 16:00;4B/03/05
Görüşme Saatleri ve Yeri salıları; 15:30, 4. kat, B koridoru, Misafir öğretim Üyeleri Odası
Öğretim Yöntem ve Teknikleri -Öğrenci odaklı, komunikatif
Temel Kaynaklar -·         Menschen, Deutsch als Fremdsprache , Kursbuch (A1.1) Sandra Evans, Angela Pude, Franz Specht(ISBN-978-3-19-301901-1)

·         Menschen, Deutsch als Fremdsprache, Arbeitsbuch(A1.1) Sabine Glas-Peters, Angela Pude, Monika Reimann(ISBN 978-3-19-311901-8)

Sözlük, Pons: Almanca- Türkçe

Türkçe- Almanca

Diğer Kaynaklar A. Güvenir tarafından hazırlanmış ve derlenmiş çalışma kağıtları(fotoki olarak)
Haftalık Ders Programı
Hafta Dersin İçeriği Öğretim Yöntem ve Teknikleri
1. Hafta Renkler, materyal tanımı, form doldurma, belirli belirsiz ve negatif artikeller, tekil ve çoğul sözcükler SU
2. Hafta İnternetten sipariş verme, bir eşyayı tanımlayabilme(renk, malzeme gibi) SU
3. Hafta Telefon konuşmaları, e-posta ve sms okuma ve özellikleri, ofis ve bilgisayar sözcükleri SU
4. Hafta Video ve ilgili çalışmalar, metin okuma ve yanıtlama: Leipzig(gece bit pazarı) SU
5. Hafta Hobiler, boş zaman değerlendirme yapabilmek fiili ; bir şey için rica edebilme SU
6. Hafta 6. hafta Yapılan konuların tekrarı, sınava hazırlık SU
7. Hafta vize
8. Hafta vize
9. Hafta Saat, günün zaman dilimleri,ve zamanla ilgili sorular, cümle yapısı, SU
10. Hafta Randevu verme, zaman dilimleriyle ilgili çalışmalar, edat SU
11. Hafta Buluşma önerisi, buluşmayı iptal etme; bu konuyla ilgili e-posta yazma SU
12. Hafta Konu tekrarı, çeşitli çalışma kağıtlarıyla çalışma, video SU
13. Hafta Ayrılabilen filler; almak fiili, taşıt araçları SU
14. Hafta Yeme içme, meyve ve sebzeler, kahvaltı ve yemek üstüne konuşma, sıfatlar SU
15. Hafta Tekrar, bileşik sözcükler,istemek fiili SU
16. Hafta Final Sınavı
17. Hafta
Değerlendirme Ölçütleri
Ölçüt Tipleri Adet Yüzdesi(%)